C20H28N2O3 — CID 159384207
(2S,3R)-N,3-dihydroxy-2-[1-(4-phenylphenyl)propylamino]butanamide;methane (PubChem CID 159384207) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (2S,3R)-N,3-dihydroxy-2-[1-(4-phenylphenyl)propylamino]butanamide;methane.
| Compound Name | (2S,3R)-N,3-dihydroxy-2-[1-(4-phenylphenyl)propylamino]butanamide;methane |
|---|---|
| PubChem CID | 159384207 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (2S,3R)-N,3-dihydroxy-2-[1-(4-phenylphenyl)propylamino]butanamide;methane |
| SMILES | C.CCC(N[C@H](C(=O)NO)[C@@H](C)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H24N2O3.CH4/c1-3-17(20-18(13(2)22)19(23)21-24)16-11-9-15(10-12-16)14-7-5-4-6-8-14;/h4-13,17-18,20,22,24H,3H2,1-2H3,(H,21,23);1H4/t13-,17?,18+;/m1./s1 |
| InChIKey | LLHGGFWOCLQMBX-LECFKMMGSA-N |
| XLogP | 3.29 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|