C20H30ClN3O4 — CID 54075386
(2R)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-2-[3-[4-(chloromethyl)phenyl]propyl]-N'-hydroxybutanediamide (PubChem CID 54075386) has the molecular formula C20H30ClN3O4 and a molecular weight of 411.93 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-2-[3-[4-(chloromethyl)phenyl]propyl]-N'-hydroxybutanediamide.
| Compound Name | (2R)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-2-[3-[4-(chloromethyl)phenyl]propyl]-N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 54075386 |
| Molecular Formula | C20H30ClN3O4 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (2R)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-2-[3-[4-(chloromethyl)phenyl]propyl]-N'-hydroxybutanediamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CCCc1ccc(CCl)cc1)CC(=O)NO)C(N)=O |
| InChI | InChI=1S/C20H30ClN3O4/c1-20(2,3)17(18(22)26)23-19(27)15(11-16(25)24-28)6-4-5-13-7-9-14(12-21)10-8-13/h7-10,15,17,28H,4-6,11-12H2,1-3H3,(H2,22,26)(H,23,27)(H,24,25)/t15-,17-/m1/s1 |
| InChIKey | MJHZOZGACHRZJW-NVXWUHKLSA-N |
| XLogP | 2.28 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|