C27H36N2O5 — CID 10073348
(2R)-N-[(2S)-3,3-dimethyl-1-oxo-1-phenylbutan-2-yl]-N'-hydroxy-2-(4-phenylmethoxybutyl)butanediamide (PubChem CID 10073348) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is (2R)-N-[(2S)-3,3-dimethyl-1-oxo-1-phenylbutan-2-yl]-N'-hydroxy-2-(4-phenylmethoxybutyl)butanediamide.
| Compound Name | (2R)-N-[(2S)-3,3-dimethyl-1-oxo-1-phenylbutan-2-yl]-N'-hydroxy-2-(4-phenylmethoxybutyl)butanediamide |
|---|---|
| PubChem CID | 10073348 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | (2R)-N-[(2S)-3,3-dimethyl-1-oxo-1-phenylbutan-2-yl]-N'-hydroxy-2-(4-phenylmethoxybutyl)butanediamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CCCCOCc1ccccc1)CC(=O)NO)C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H36N2O5/c1-27(2,3)25(24(31)21-14-8-5-9-15-21)28-26(32)22(18-23(30)29-33)16-10-11-17-34-19-20-12-6-4-7-13-20/h4-9,12-15,22,25,33H,10-11,16-19H2,1-3H3,(H,28,32)(H,29,30)/t22-,25-/m1/s1 |
| InChIKey | NIMLMMHXQQABIR-RCZVLFRGSA-N |
| XLogP | 4.30 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|