C20H38N2O6 — CID 23391705
2-methoxyethyl (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hexanoyl]amino]-3,3-dimethylbutanoate (PubChem CID 23391705) has the molecular formula C20H38N2O6 and a molecular weight of 402.53 g/mol. Its IUPAC name is 2-methoxyethyl (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hexanoyl]amino]-3,3-dimethylbutanoate.
| Compound Name | 2-methoxyethyl (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hexanoyl]amino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 23391705 |
| Molecular Formula | C20H38N2O6 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 2-methoxyethyl (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hexanoyl]amino]-3,3-dimethylbutanoate |
| SMILES | CCC[C@H](C(=O)NO)[C@@H](CC(C)C)C(=O)N[C@H](C(=O)OCCOC)C(C)(C)C |
| InChI | InChI=1S/C20H38N2O6/c1-8-9-14(18(24)22-26)15(12-13(2)3)17(23)21-16(20(4,5)6)19(25)28-11-10-27-7/h13-16,26H,8-12H2,1-7H3,(H,21,23)(H,22,24)/t14-,15+,16+/m0/s1 |
| InChIKey | PYXMKUGNERXOPH-ARFHVFGLSA-N |
| XLogP | 2.29 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|