C7H15O6PS — CID 174830143
S-(2-phosphonooxyethyl) 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 174830143) has the molecular formula C7H15O6PS and a molecular weight of 258.23 g/mol. Its IUPAC name is S-(2-phosphonooxyethyl) 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-(2-phosphonooxyethyl) 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 174830143 |
| Molecular Formula | C7H15O6PS |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | S-(2-phosphonooxyethyl) 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCOP(=O)(O)O |
| InChI | InChI=1S/C7H15O6PS/c1-7(2,5-8)6(9)15-4-3-13-14(10,11)12/h8H,3-5H2,1-2H3,(H2,10,11,12) |
| InChIKey | JTAVGNAFTTZXPM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|