C12H22O3S — CID 89371281
S-(2-methoxyethyl) 3-cyclobutyloxy-2,2-dimethylpropanethioate (PubChem CID 89371281) has the molecular formula C12H22O3S and a molecular weight of 246.37 g/mol. Its IUPAC name is S-(2-methoxyethyl) 3-cyclobutyloxy-2,2-dimethylpropanethioate.
| Compound Name | S-(2-methoxyethyl) 3-cyclobutyloxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 89371281 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | S-(2-methoxyethyl) 3-cyclobutyloxy-2,2-dimethylpropanethioate |
| SMILES | COCCSC(=O)C(C)(C)COC1CCC1 |
| InChI | InChI=1S/C12H22O3S/c1-12(2,9-15-10-5-4-6-10)11(13)16-8-7-14-3/h10H,4-9H2,1-3H3 |
| InChIKey | ILNOQQHSOODWBD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|