C11H21NO4S — CID 144606300
S-(2-methoxyethyl) 4-(methoxycarbonylamino)-2,2-dimethylbutanethioate (PubChem CID 144606300) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is S-(2-methoxyethyl) 4-(methoxycarbonylamino)-2,2-dimethylbutanethioate.
| Compound Name | S-(2-methoxyethyl) 4-(methoxycarbonylamino)-2,2-dimethylbutanethioate |
|---|---|
| PubChem CID | 144606300 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | S-(2-methoxyethyl) 4-(methoxycarbonylamino)-2,2-dimethylbutanethioate |
| SMILES | COCCSC(=O)C(C)(C)CCNC(=O)OC |
| InChI | InChI=1S/C11H21NO4S/c1-11(2,5-6-12-10(14)16-4)9(13)17-8-7-15-3/h5-8H2,1-4H3,(H,12,14) |
| InChIKey | LUNXIZLCNYMMSE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|