C10H23NO5SSi — CID 155628473
S-(2-methoxyethyl) N-(3-trimethoxysilylpropyl)carbamothioate (PubChem CID 155628473) has the molecular formula C10H23NO5SSi and a molecular weight of 297.45 g/mol. Its IUPAC name is S-(2-methoxyethyl) N-(3-trimethoxysilylpropyl)carbamothioate.
| Compound Name | S-(2-methoxyethyl) N-(3-trimethoxysilylpropyl)carbamothioate |
|---|---|
| PubChem CID | 155628473 |
| Molecular Formula | C10H23NO5SSi |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | S-(2-methoxyethyl) N-(3-trimethoxysilylpropyl)carbamothioate |
| SMILES | COCCSC(=O)NCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H23NO5SSi/c1-13-7-8-17-10(12)11-6-5-9-18(14-2,15-3)16-4/h5-9H2,1-4H3,(H,11,12) |
| InChIKey | OQEZSNWOSVOMOE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|