C20H40N2O6S4 — CID 139241416
S-[2-[2-(2-sulfanylethoxy)ethoxy]ethyl] N-[6-[2-[2-(2-sulfanylethoxy)ethoxy]ethylsulfanylcarbonylamino]hexyl]carbamothioate (PubChem CID 139241416) has the molecular formula C20H40N2O6S4 and a molecular weight of 532.82 g/mol. Its IUPAC name is S-[2-[2-(2-sulfanylethoxy)ethoxy]ethyl] N-[6-[2-[2-(2-sulfanylethoxy)ethoxy]ethylsulfanylcarbonylamino]hexyl]carbamothioate.
| Compound Name | S-[2-[2-(2-sulfanylethoxy)ethoxy]ethyl] N-[6-[2-[2-(2-sulfanylethoxy)ethoxy]ethylsulfanylcarbonylamino]hexyl]carbamothioate |
|---|---|
| PubChem CID | 139241416 |
| Molecular Formula | C20H40N2O6S4 |
| Molecular Weight | 532.82 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | S-[2-[2-(2-sulfanylethoxy)ethoxy]ethyl] N-[6-[2-[2-(2-sulfanylethoxy)ethoxy]ethylsulfanylcarbonylamino]hexyl]carbamothioate |
| SMILES | O=C(NCCCCCCNC(=O)SCCOCCOCCS)SCCOCCOCCS |
| InChI | InChI=1S/C20H40N2O6S4/c23-19(31-17-13-27-9-7-25-11-15-29)21-5-3-1-2-4-6-22-20(24)32-18-14-28-10-8-26-12-16-30/h29-30H,1-18H2,(H,21,23)(H,22,24) |
| InChIKey | GXRPRHGUWSEAKI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.82 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|