C28H53IN4O9S2 — CID 172581093
[6-[2-[2-[2-[[7-(iodooxycarbonylamino)-7-methyloctyl]carbamoylsulfanyl]ethoxy]ethoxy]ethylsulfanylcarbonylamino]-6-methyloctyl]carbamoperoxoic acid (PubChem CID 172581093) has the molecular formula C28H53IN4O9S2 and a molecular weight of 780.79 g/mol. Its IUPAC name is [6-[2-[2-[2-[[7-(iodooxycarbonylamino)-7-methyloctyl]carbamoylsulfanyl]ethoxy]ethoxy]ethylsulfanylcarbonylamino]-6-methyloctyl]carbamoperoxoic acid.
| Compound Name | [6-[2-[2-[2-[[7-(iodooxycarbonylamino)-7-methyloctyl]carbamoylsulfanyl]ethoxy]ethoxy]ethylsulfanylcarbonylamino]-6-methyloctyl]carbamoperoxoic acid |
|---|---|
| PubChem CID | 172581093 |
| Molecular Formula | C28H53IN4O9S2 |
| Molecular Weight | 780.79 g/mol |
| Exact Mass | 780.23 |
| IUPAC Name | [6-[2-[2-[2-[[7-(iodooxycarbonylamino)-7-methyloctyl]carbamoylsulfanyl]ethoxy]ethoxy]ethylsulfanylcarbonylamino]-6-methyloctyl]carbamoperoxoic acid |
| SMILES | CCC(C)(CCCCCNC(=O)OO)NC(=O)SCCOCCOCCSC(=O)NCCCCCCC(C)(C)NC(=O)OI |
| InChI | InChI=1S/C28H53IN4O9S2/c1-5-28(4,14-10-8-12-15-30-23(34)42-38)33-26(37)44-22-20-40-18-17-39-19-21-43-25(36)31-16-11-7-6-9-13-27(2,3)32-24(35)41-29/h38H,5-22H2,1-4H3,(H,30,34)(H,31,36)(H,32,35)(H,33,37) |
| InChIKey | VZDXPNSVDRFCFE-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 173.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.79 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|