C12H22O5S2 — CID 132596097
S-[2-[2-[2-(2-acetylsulfanylethoxy)ethoxy]ethoxy]ethyl] ethanethioate (PubChem CID 132596097) has the molecular formula C12H22O5S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is S-[2-[2-[2-(2-acetylsulfanylethoxy)ethoxy]ethoxy]ethyl] ethanethioate.
| Compound Name | S-[2-[2-[2-(2-acetylsulfanylethoxy)ethoxy]ethoxy]ethyl] ethanethioate |
|---|---|
| PubChem CID | 132596097 |
| Molecular Formula | C12H22O5S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | S-[2-[2-[2-(2-acetylsulfanylethoxy)ethoxy]ethoxy]ethyl] ethanethioate |
| SMILES | CC(=O)SCCOCCOCCOCCSC(C)=O |
| InChI | InChI=1S/C12H22O5S2/c1-11(13)18-9-7-16-5-3-15-4-6-17-8-10-19-12(2)14/h3-10H2,1-2H3 |
| InChIKey | WAUWWFNDPZYKGN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|