C10H20N4O4SSi — CID 165008256
S-[(5-amino-4H-pyrazol-3-yl)] N-(3-trimethoxysilylpropyl)carbamothioate (PubChem CID 165008256) has the molecular formula C10H20N4O4SSi and a molecular weight of 320.45 g/mol. Its IUPAC name is S-[(5-amino-4H-pyrazol-3-yl)] N-(3-trimethoxysilylpropyl)carbamothioate.
| Compound Name | S-[(5-amino-4H-pyrazol-3-yl)] N-(3-trimethoxysilylpropyl)carbamothioate |
|---|---|
| PubChem CID | 165008256 |
| Molecular Formula | C10H20N4O4SSi |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | S-[(5-amino-4H-pyrazol-3-yl)] N-(3-trimethoxysilylpropyl)carbamothioate |
| SMILES | CO[Si](CCCNC(=O)SC1=NN=C(N)C1)(OC)OC |
| InChI | InChI=1S/C10H20N4O4SSi/c1-16-20(17-2,18-3)6-4-5-12-10(15)19-9-7-8(11)13-14-9/h4-7H2,1-3H3,(H2,11,13)(H,12,15) |
| InChIKey | JHKPMQPTKKWCOO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|