C13H26O3S — CID 89371270
S-(2-methoxyethyl) 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butanethioate (PubChem CID 89371270) has the molecular formula C13H26O3S and a molecular weight of 262.41 g/mol. Its IUPAC name is S-(2-methoxyethyl) 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butanethioate.
| Compound Name | S-(2-methoxyethyl) 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butanethioate |
|---|---|
| PubChem CID | 89371270 |
| Molecular Formula | C13H26O3S |
| Molecular Weight | 262.41 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | S-(2-methoxyethyl) 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butanethioate |
| SMILES | COCCSC(=O)C(C)(C)CCOC(C)(C)C |
| InChI | InChI=1S/C13H26O3S/c1-12(2,3)16-8-7-13(4,5)11(14)17-10-9-15-6/h7-10H2,1-6H3 |
| InChIKey | BPWGBMAIGRDFGQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|