C12H22O3S2 — CID 88692137
S-(2,2-dimethylpropanoylsulfanylmethoxymethyl) 2,2-dimethylpropanethioate (PubChem CID 88692137) has the molecular formula C12H22O3S2 and a molecular weight of 278.44 g/mol. Its IUPAC name is S-(2,2-dimethylpropanoylsulfanylmethoxymethyl) 2,2-dimethylpropanethioate.
| Compound Name | S-(2,2-dimethylpropanoylsulfanylmethoxymethyl) 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 88692137 |
| Molecular Formula | C12H22O3S2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | S-(2,2-dimethylpropanoylsulfanylmethoxymethyl) 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCOCSC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H22O3S2/c1-11(2,3)9(13)16-7-15-8-17-10(14)12(4,5)6/h7-8H2,1-6H3 |
| InChIKey | JVDCDLBLGGENFJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|