C11H23NO4S — CID 145328502
S-[(2R)-2-(hydroxymethoxycarbonylamino)butyl] 2,2-dimethylpropanethioate;molecular hydrogen (PubChem CID 145328502) has the molecular formula C11H23NO4S and a molecular weight of 265.37 g/mol. Its IUPAC name is S-[(2R)-2-(hydroxymethoxycarbonylamino)butyl] 2,2-dimethylpropanethioate;molecular hydrogen.
| Compound Name | S-[(2R)-2-(hydroxymethoxycarbonylamino)butyl] 2,2-dimethylpropanethioate;molecular hydrogen |
|---|---|
| PubChem CID | 145328502 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | S-[(2R)-2-(hydroxymethoxycarbonylamino)butyl] 2,2-dimethylpropanethioate;molecular hydrogen |
| SMILES | CC[C@H](CSC(=O)C(C)(C)C)NC(=O)OCO.[H][H] |
| InChI | InChI=1S/C11H21NO4S.H2/c1-5-8(12-10(15)16-7-13)6-17-9(14)11(2,3)4;/h8,13H,5-7H2,1-4H3,(H,12,15);1H/t8-;/m1./s1 |
| InChIKey | MCLNHDFRTGGFFL-DDWIOCJRSA-N |
| XLogP | 1.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|