1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid

C7H12F3NO2S — CID 130236304

IUPAC1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid
SMILESCCC(CSCC(F)(F)F)NC(=O)O
InChIInChI=1S/C7H12F3NO2S/c1-2-5(11-6(12)13)3-14-4-7(8,9)10/h5,11H,2-4H2,1H3,(H,12,13)
InChIKeyRTNDROUQLVRNGS-UHFFFAOYSA-N
MW231.24 g/mol
LogP2.33
Rot. Bonds5

About 1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid

1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid (PubChem CID 130236304) has the molecular formula C7H12F3NO2S and a molecular weight of 231.24 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid.

Molecular Properties

Compound Name1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid
PubChem CID130236304
Molecular FormulaC7H12F3NO2S
Molecular Weight231.24 g/mol
Exact Mass231.05
IUPAC Name1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid
SMILESCCC(CSCC(F)(F)F)NC(=O)O
InChIInChI=1S/C7H12F3NO2S/c1-2-5(11-6(12)13)3-14-4-7(8,9)10/h5,11H,2-4H2,1H3,(H,12,13)
InChIKeyRTNDROUQLVRNGS-UHFFFAOYSA-N
XLogP2.33
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.24
LogP ≤ 52.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid?
The IUPAC name of 1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid (CID 130236304) is 1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid.
What is the SMILES notation for 1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid?
The canonical SMILES for 1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid is CCC(CSCC(F)(F)F)NC(=O)O.
What is the InChIKey of 1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid?
The InChIKey is RTNDROUQLVRNGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3NO2S/c1-2-5(11-6(12)13)3-14-4-7(8,9)10/h5,11H,2-4H2,1H3,(H,12,13).
What are the key properties of 1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid?
1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid has a molecular weight of 231.24 g/mol, XLogP of 2.33, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,2-trifluoroethylsulfanyl)butan-2-ylcarbamic acid is sourced from PubChem (CID 130236304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).