C7H14FNO3 — CID 87493222
[(2S)-4-fluoro-1-hydroxy-4-methylpentan-2-yl]carbamic acid (PubChem CID 87493222) has the molecular formula C7H14FNO3 and a molecular weight of 179.19 g/mol. Its IUPAC name is [(2S)-4-fluoro-1-hydroxy-4-methylpentan-2-yl]carbamic acid.
| Compound Name | [(2S)-4-fluoro-1-hydroxy-4-methylpentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87493222 |
| Molecular Formula | C7H14FNO3 |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.10 |
| IUPAC Name | [(2S)-4-fluoro-1-hydroxy-4-methylpentan-2-yl]carbamic acid |
| SMILES | CC(C)(F)C[C@@H](CO)NC(=O)O |
| InChI | InChI=1S/C7H14FNO3/c1-7(2,8)3-5(4-10)9-6(11)12/h5,9-10H,3-4H2,1-2H3,(H,11,12)/t5-/m0/s1 |
| InChIKey | KGWDCYDQVVEANY-YFKPBYRVSA-N |
| XLogP | 0.75 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |