C5H10N2O5 — CID 129243469
[(2R)-1-(carboxyamino)-3-hydroxypropan-2-yl]carbamic acid (PubChem CID 129243469) has the molecular formula C5H10N2O5 and a molecular weight of 178.14 g/mol. Its IUPAC name is [(2R)-1-(carboxyamino)-3-hydroxypropan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-(carboxyamino)-3-hydroxypropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 129243469 |
| Molecular Formula | C5H10N2O5 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | [(2R)-1-(carboxyamino)-3-hydroxypropan-2-yl]carbamic acid |
| SMILES | O=C(O)NC[C@H](CO)NC(=O)O |
| InChI | InChI=1S/C5H10N2O5/c8-2-3(7-5(11)12)1-6-4(9)10/h3,6-8H,1-2H2,(H,9,10)(H,11,12)/t3-/m1/s1 |
| InChIKey | UOWKMZFXKKGXMA-GSVOUGTGSA-N |
| XLogP | -1.12 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |