C18H35NO3 — CID 151625474
[(2S)-4,5-dibutyl-1-hydroxynon-4-en-2-yl]carbamic acid (PubChem CID 151625474) has the molecular formula C18H35NO3 and a molecular weight of 313.48 g/mol. Its IUPAC name is [(2S)-4,5-dibutyl-1-hydroxynon-4-en-2-yl]carbamic acid.
| Compound Name | [(2S)-4,5-dibutyl-1-hydroxynon-4-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 151625474 |
| Molecular Formula | C18H35NO3 |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | [(2S)-4,5-dibutyl-1-hydroxynon-4-en-2-yl]carbamic acid |
| SMILES | CCCCC(CCCC)=C(CCCC)C[C@@H](CO)NC(=O)O |
| InChI | InChI=1S/C18H35NO3/c1-4-7-10-15(11-8-5-2)16(12-9-6-3)13-17(14-20)19-18(21)22/h17,19-20H,4-14H2,1-3H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | QPKFEYVOUQVGEK-KRWDZBQOSA-N |
| XLogP | 4.87 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|