C13H22O3SSi — CID 10902229
trimethylsilyl 5-(2,2-dimethylpropanoylsulfanyl)pent-3-ynoate (PubChem CID 10902229) has the molecular formula C13H22O3SSi and a molecular weight of 286.47 g/mol. Its IUPAC name is trimethylsilyl 5-(2,2-dimethylpropanoylsulfanyl)pent-3-ynoate.
| Compound Name | trimethylsilyl 5-(2,2-dimethylpropanoylsulfanyl)pent-3-ynoate |
|---|---|
| PubChem CID | 10902229 |
| Molecular Formula | C13H22O3SSi |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | trimethylsilyl 5-(2,2-dimethylpropanoylsulfanyl)pent-3-ynoate |
| SMILES | CC(C)(C)C(=O)SCC#CCC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C13H22O3SSi/c1-13(2,3)12(15)17-10-8-7-9-11(14)16-18(4,5)6/h9-10H2,1-6H3 |
| InChIKey | CQTVQDGGEUNGAW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|