C19H38NO4PS2 — CID 91122279
O-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl] 2,2-dimethylpropanethioate (PubChem CID 91122279) has the molecular formula C19H38NO4PS2 and a molecular weight of 439.62 g/mol. Its IUPAC name is O-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl] 2,2-dimethylpropanethioate.
| Compound Name | O-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 91122279 |
| Molecular Formula | C19H38NO4PS2 |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | O-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)N(C(C)C)[P@@](OCCSC(=O)C(C)(C)C)OCOC(=S)C(C)(C)C |
| InChI | InChI=1S/C19H38NO4PS2/c1-14(2)20(15(3)4)25(24-13-22-17(26)19(8,9)10)23-11-12-27-16(21)18(5,6)7/h14-15H,11-13H2,1-10H3/t25-/m0/s1 |
| InChIKey | MQKZMVYRUNLGMO-VWLOTQADSA-N |
| XLogP | 6.02 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|