C21H46N3O3PS — CID 89082742
S-[2-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxy]ethyl] 3-amino-2-methylbutanethioate (PubChem CID 89082742) has the molecular formula C21H46N3O3PS and a molecular weight of 451.66 g/mol. Its IUPAC name is S-[2-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxy]ethyl] 3-amino-2-methylbutanethioate.
| Compound Name | S-[2-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxy]ethyl] 3-amino-2-methylbutanethioate |
|---|---|
| PubChem CID | 89082742 |
| Molecular Formula | C21H46N3O3PS |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | S-[2-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxy]ethyl] 3-amino-2-methylbutanethioate |
| SMILES | CC(N)C(C)C(=O)SCCOCCOP(N(C(C)C)C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C21H46N3O3PS/c1-15(2)23(16(3)4)28(24(17(5)6)18(7)8)27-12-11-26-13-14-29-21(25)19(9)20(10)22/h15-20H,11-14,22H2,1-10H3 |
| InChIKey | XHLUWJUHIWISAJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|