C22H41N3O3PS+ — CID 58533987
S-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxymethyl] 1-methylpyridin-1-ium-4-carbothioate (PubChem CID 58533987) has the molecular formula C22H41N3O3PS+ and a molecular weight of 458.63 g/mol. Its IUPAC name is S-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxymethyl] 1-methylpyridin-1-ium-4-carbothioate.
| Compound Name | S-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxymethyl] 1-methylpyridin-1-ium-4-carbothioate |
|---|---|
| PubChem CID | 58533987 |
| Molecular Formula | C22H41N3O3PS+ |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | S-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxymethyl] 1-methylpyridin-1-ium-4-carbothioate |
| SMILES | CC(C)N(C(C)C)P(OCCOCSC(=O)c1cc[n+](C)cc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C22H41N3O3PS/c1-17(2)24(18(3)4)29(25(19(5)6)20(7)8)28-15-14-27-16-30-22(26)21-10-12-23(9)13-11-21/h10-13,17-20H,14-16H2,1-9H3/q+1 |
| InChIKey | ZCWWMOWCWAKHIO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 45.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|