C20H44N3O3PS — CID 89082713
S-[2-[bis[di(propan-2-yl)amino]phosphanyloxymethoxy]ethyl] 3-amino-2,2-dimethylpropanethioate (PubChem CID 89082713) has the molecular formula C20H44N3O3PS and a molecular weight of 437.63 g/mol. Its IUPAC name is S-[2-[bis[di(propan-2-yl)amino]phosphanyloxymethoxy]ethyl] 3-amino-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[bis[di(propan-2-yl)amino]phosphanyloxymethoxy]ethyl] 3-amino-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 89082713 |
| Molecular Formula | C20H44N3O3PS |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | S-[2-[bis[di(propan-2-yl)amino]phosphanyloxymethoxy]ethyl] 3-amino-2,2-dimethylpropanethioate |
| SMILES | CC(C)N(C(C)C)P(OCOCCSC(=O)C(C)(C)CN)N(C(C)C)C(C)C |
| InChI | InChI=1S/C20H44N3O3PS/c1-15(2)22(16(3)4)27(23(17(5)6)18(7)8)26-14-25-11-12-28-19(24)20(9,10)13-21/h15-18H,11-14,21H2,1-10H3 |
| InChIKey | SSKHYNVDPARQOG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|