C22H47N2O3PS — CID 58533834
S-[1-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxy]-2-methylpropan-2-yl] 2-methylpropanethioate (PubChem CID 58533834) has the molecular formula C22H47N2O3PS and a molecular weight of 450.67 g/mol. Its IUPAC name is S-[1-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxy]-2-methylpropan-2-yl] 2-methylpropanethioate.
| Compound Name | S-[1-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxy]-2-methylpropan-2-yl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 58533834 |
| Molecular Formula | C22H47N2O3PS |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | S-[1-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxy]-2-methylpropan-2-yl] 2-methylpropanethioate |
| SMILES | CC(C)C(=O)SC(C)(C)COCCOP(N(C(C)C)C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C22H47N2O3PS/c1-16(2)21(25)29-22(11,12)15-26-13-14-27-28(23(17(3)4)18(5)6)24(19(7)8)20(9)10/h16-20H,13-15H2,1-12H3 |
| InChIKey | YQXWHTNLVOCYIG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|