C17H39N2OP — CID 90129499
N-[2,2-dimethylpropoxy-[di(propan-2-yl)amino]phosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 90129499) has the molecular formula C17H39N2OP and a molecular weight of 318.49 g/mol. Its IUPAC name is N-[2,2-dimethylpropoxy-[di(propan-2-yl)amino]phosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[2,2-dimethylpropoxy-[di(propan-2-yl)amino]phosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 90129499 |
| Molecular Formula | C17H39N2OP |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | N-[2,2-dimethylpropoxy-[di(propan-2-yl)amino]phosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)N(C(C)C)P(OCC(C)(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C17H39N2OP/c1-13(2)18(14(3)4)21(20-12-17(9,10)11)19(15(5)6)16(7)8/h13-16H,12H2,1-11H3 |
| InChIKey | LSTPIYUOJVCHCT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|