C15H30F5N2OP — CID 155410275
N-[[di(propan-2-yl)amino]-(2,2,3,3,3-pentafluoropropoxy)phosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 155410275) has the molecular formula C15H30F5N2OP and a molecular weight of 380.38 g/mol. Its IUPAC name is N-[[di(propan-2-yl)amino]-(2,2,3,3,3-pentafluoropropoxy)phosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[[di(propan-2-yl)amino]-(2,2,3,3,3-pentafluoropropoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 155410275 |
| Molecular Formula | C15H30F5N2OP |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-[[di(propan-2-yl)amino]-(2,2,3,3,3-pentafluoropropoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)N(C(C)C)P(OCC(F)(F)C(F)(F)F)N(C(C)C)C(C)C |
| InChI | InChI=1S/C15H30F5N2OP/c1-10(2)21(11(3)4)24(22(12(5)6)13(7)8)23-9-14(16,17)15(18,19)20/h10-13H,9H2,1-8H3 |
| InChIKey | MYVNSBZKYQFNLK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|