C18H40N3O3PS — CID 89082735
S-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxymethyl] 3-aminopropanethioate (PubChem CID 89082735) has the molecular formula C18H40N3O3PS and a molecular weight of 409.58 g/mol. Its IUPAC name is S-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxymethyl] 3-aminopropanethioate.
| Compound Name | S-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxymethyl] 3-aminopropanethioate |
|---|---|
| PubChem CID | 89082735 |
| Molecular Formula | C18H40N3O3PS |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | S-[2-bis[di(propan-2-yl)amino]phosphanyloxyethoxymethyl] 3-aminopropanethioate |
| SMILES | CC(C)N(C(C)C)P(OCCOCSC(=O)CCN)N(C(C)C)C(C)C |
| InChI | InChI=1S/C18H40N3O3PS/c1-14(2)20(15(3)4)25(21(16(5)6)17(7)8)24-12-11-23-13-26-18(22)9-10-19/h14-17H,9-13,19H2,1-8H3 |
| InChIKey | WQJWOMUQHVSLNP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|