C21H46N3O4PS — CID 89082737
S-[2-[2-bis[di(propan-2-yl)amino]phosphanyloxy-1-ethoxyethoxy]ethyl] 3-aminopropanethioate (PubChem CID 89082737) has the molecular formula C21H46N3O4PS and a molecular weight of 467.66 g/mol. Its IUPAC name is S-[2-[2-bis[di(propan-2-yl)amino]phosphanyloxy-1-ethoxyethoxy]ethyl] 3-aminopropanethioate.
| Compound Name | S-[2-[2-bis[di(propan-2-yl)amino]phosphanyloxy-1-ethoxyethoxy]ethyl] 3-aminopropanethioate |
|---|---|
| PubChem CID | 89082737 |
| Molecular Formula | C21H46N3O4PS |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | S-[2-[2-bis[di(propan-2-yl)amino]phosphanyloxy-1-ethoxyethoxy]ethyl] 3-aminopropanethioate |
| SMILES | CCOC(COP(N(C(C)C)C(C)C)N(C(C)C)C(C)C)OCCSC(=O)CCN |
| InChI | InChI=1S/C21H46N3O4PS/c1-10-26-21(27-13-14-30-20(25)11-12-22)15-28-29(23(16(2)3)17(4)5)24(18(6)7)19(8)9/h16-19,21H,10-15,22H2,1-9H3 |
| InChIKey | JJHHXUFUVCFAGX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|