C23H48N3O4PS — CID 89082764
S-[2-[2-bis[di(propan-2-yl)amino]phosphanyloxy-1-ethoxyethoxy]ethyl] (E)-3-amino-2-methylbut-2-enethioate (PubChem CID 89082764) has the molecular formula C23H48N3O4PS and a molecular weight of 493.70 g/mol. Its IUPAC name is S-[2-[2-bis[di(propan-2-yl)amino]phosphanyloxy-1-ethoxyethoxy]ethyl] (E)-3-amino-2-methylbut-2-enethioate.
| Compound Name | S-[2-[2-bis[di(propan-2-yl)amino]phosphanyloxy-1-ethoxyethoxy]ethyl] (E)-3-amino-2-methylbut-2-enethioate |
|---|---|
| PubChem CID | 89082764 |
| Molecular Formula | C23H48N3O4PS |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.31 |
| IUPAC Name | S-[2-[2-bis[di(propan-2-yl)amino]phosphanyloxy-1-ethoxyethoxy]ethyl] (E)-3-amino-2-methylbut-2-enethioate |
| SMILES | CCOC(COP(N(C(C)C)C(C)C)N(C(C)C)C(C)C)OCCSC(=O)/C(C)=C(\C)N |
| InChI | InChI=1S/C23H48N3O4PS/c1-12-28-22(29-13-14-32-23(27)20(10)21(11)24)15-30-31(25(16(2)3)17(4)5)26(18(6)7)19(8)9/h16-19,22H,12-15,24H2,1-11H3/b21-20+ |
| InChIKey | KUSDFSSPTFNBIW-QZQOTICOSA-N |
| XLogP | 5.36 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|