C24H52N3O3PS — CID 91371541
S-[3-bis[di(propan-2-yl)amino]phosphanyloxypropoxymethyl] N-(3-ethylpentan-3-yl)carbamothioate (PubChem CID 91371541) has the molecular formula C24H52N3O3PS and a molecular weight of 493.74 g/mol. Its IUPAC name is S-[3-bis[di(propan-2-yl)amino]phosphanyloxypropoxymethyl] N-(3-ethylpentan-3-yl)carbamothioate.
| Compound Name | S-[3-bis[di(propan-2-yl)amino]phosphanyloxypropoxymethyl] N-(3-ethylpentan-3-yl)carbamothioate |
|---|---|
| PubChem CID | 91371541 |
| Molecular Formula | C24H52N3O3PS |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 493.35 |
| IUPAC Name | S-[3-bis[di(propan-2-yl)amino]phosphanyloxypropoxymethyl] N-(3-ethylpentan-3-yl)carbamothioate |
| SMILES | CCC(CC)(CC)NC(=O)SCOCCCOP(N(C(C)C)C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C24H52N3O3PS/c1-12-24(13-2,14-3)25-23(28)32-18-29-16-15-17-30-31(26(19(4)5)20(6)7)27(21(8)9)22(10)11/h19-22H,12-18H2,1-11H3,(H,25,28) |
| InChIKey | WOSZPRVIYKIXAI-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|