C24H52N3O4PS — CID 58533835
S-[bis[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 3-[di(propan-2-yl)amino]propanethioate (PubChem CID 58533835) has the molecular formula C24H52N3O4PS and a molecular weight of 509.74 g/mol. Its IUPAC name is S-[bis[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 3-[di(propan-2-yl)amino]propanethioate.
| Compound Name | S-[bis[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 3-[di(propan-2-yl)amino]propanethioate |
|---|---|
| PubChem CID | 58533835 |
| Molecular Formula | C24H52N3O4PS |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.34 |
| IUPAC Name | S-[bis[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 3-[di(propan-2-yl)amino]propanethioate |
| SMILES | CC(C)N(CCC(=O)SCOCOCOP(N(C(C)C)C(C)C)N(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C24H52N3O4PS/c1-18(2)25(19(3)4)14-13-24(28)33-17-30-15-29-16-31-32(26(20(5)6)21(7)8)27(22(9)10)23(11)12/h18-23H,13-17H2,1-12H3 |
| InChIKey | GQEQANVUPKXXLH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|