C14H31N2O4PS — CID 118964781
S-[[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 3-(dimethylamino)propanethioate (PubChem CID 118964781) has the molecular formula C14H31N2O4PS and a molecular weight of 354.45 g/mol. Its IUPAC name is S-[[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 3-(dimethylamino)propanethioate.
| Compound Name | S-[[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 3-(dimethylamino)propanethioate |
|---|---|
| PubChem CID | 118964781 |
| Molecular Formula | C14H31N2O4PS |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | S-[[di(propan-2-yl)amino]phosphanyloxymethoxymethoxymethyl] 3-(dimethylamino)propanethioate |
| SMILES | CC(C)N(POCOCOCSC(=O)CCN(C)C)C(C)C |
| InChI | InChI=1S/C14H31N2O4PS/c1-12(2)16(13(3)4)21-20-10-18-9-19-11-22-14(17)7-8-15(5)6/h12-13,21H,7-11H2,1-6H3 |
| InChIKey | SJRIQOXHMJMTNT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|