About S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride
S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride (PubChem CID 23187639) has the molecular formula C8H20Cl2N2OS
and a molecular weight of 263.23 g/mol. Its IUPAC name is S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride.
Molecular Properties
| Compound Name | S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride |
| PubChem CID | 23187639 |
| Molecular Formula | C8H20Cl2N2OS |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride |
| SMILES | CN(C)CCC(=O)SCCCN.Cl.Cl |
| InChI | InChI=1S/C8H18N2OS.2ClH/c1-10(2)6-4-8(11)12-7-3-5-9;;/h3-7,9H2,1-2H3;2*1H |
| InChIKey | DYPXURIESSRQCI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride?
The IUPAC name of S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride (CID 23187639) is S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride.
What is the SMILES notation for S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride?
The canonical SMILES for S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride is CN(C)CCC(=O)SCCCN.Cl.Cl.
What is the InChIKey of S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride?
The InChIKey is DYPXURIESSRQCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2OS.2ClH/c1-10(2)6-4-8(11)12-7-3-5-9;;/h3-7,9H2,1-2H3;2*1H.
What are the key properties of S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride?
S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride has a molecular weight of 263.23 g/mol, XLogP of 1.39, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-aminopropyl) 3-(dimethylamino)propanethioate;dihydrochloride is sourced from PubChem (CID 23187639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).