About S-[2-(dimethylamino)ethyl] 3-oxobutanethioate
S-[2-(dimethylamino)ethyl] 3-oxobutanethioate (PubChem CID 20664905) has the molecular formula C8H15NO2S
and a molecular weight of 189.28 g/mol. Its IUPAC name is S-[2-(dimethylamino)ethyl] 3-oxobutanethioate.
Molecular Properties
| Compound Name | S-[2-(dimethylamino)ethyl] 3-oxobutanethioate |
| PubChem CID | 20664905 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | S-[2-(dimethylamino)ethyl] 3-oxobutanethioate |
| SMILES | CC(=O)CC(=O)SCCN(C)C |
| InChI | InChI=1S/C8H15NO2S/c1-7(10)6-8(11)12-5-4-9(2)3/h4-6H2,1-3H3 |
| InChIKey | MYMIFMOTJCJQTH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-(dimethylamino)ethyl] 3-oxobutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-(dimethylamino)ethyl] 3-oxobutanethioate?
The IUPAC name of S-[2-(dimethylamino)ethyl] 3-oxobutanethioate (CID 20664905) is S-[2-(dimethylamino)ethyl] 3-oxobutanethioate.
What is the SMILES notation for S-[2-(dimethylamino)ethyl] 3-oxobutanethioate?
The canonical SMILES for S-[2-(dimethylamino)ethyl] 3-oxobutanethioate is CC(=O)CC(=O)SCCN(C)C.
What is the InChIKey of S-[2-(dimethylamino)ethyl] 3-oxobutanethioate?
The InChIKey is MYMIFMOTJCJQTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S/c1-7(10)6-8(11)12-5-4-9(2)3/h4-6H2,1-3H3.
What are the key properties of S-[2-(dimethylamino)ethyl] 3-oxobutanethioate?
S-[2-(dimethylamino)ethyl] 3-oxobutanethioate has a molecular weight of 189.28 g/mol, XLogP of 0.79, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-(dimethylamino)ethyl] 3-oxobutanethioate is sourced from PubChem (CID 20664905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).