About S-ethyl 3-oxobutanethioate
S-ethyl 3-oxobutanethioate (PubChem CID 538325) has the molecular formula C6H10O2S
and a molecular weight of 146.21 g/mol. Its IUPAC name is S-ethyl 3-oxobutanethioate.
Molecular Properties
| Compound Name | S-ethyl 3-oxobutanethioate |
| PubChem CID | 538325 |
| Molecular Formula | C6H10O2S |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | S-ethyl 3-oxobutanethioate |
| SMILES | CCSC(=O)CC(C)=O |
| InChI | InChI=1S/C6H10O2S/c1-3-9-6(8)4-5(2)7/h3-4H2,1-2H3 |
| InChIKey | OMERQNHZTBWLMZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl 3-oxobutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl 3-oxobutanethioate?
The IUPAC name of S-ethyl 3-oxobutanethioate (CID 538325) is S-ethyl 3-oxobutanethioate.
What is the SMILES notation for S-ethyl 3-oxobutanethioate?
The canonical SMILES for S-ethyl 3-oxobutanethioate is CCSC(=O)CC(C)=O.
What is the InChIKey of S-ethyl 3-oxobutanethioate?
The InChIKey is OMERQNHZTBWLMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S/c1-3-9-6(8)4-5(2)7/h3-4H2,1-2H3.
What are the key properties of S-ethyl 3-oxobutanethioate?
S-ethyl 3-oxobutanethioate has a molecular weight of 146.21 g/mol, XLogP of 1.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl 3-oxobutanethioate is sourced from PubChem (CID 538325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).