C12H26N4O2S4 — CID 21150783
N,N'-bis[3-(dimethylamino)propyldisulfanyl]oxamide (PubChem CID 21150783) has the molecular formula C12H26N4O2S4 and a molecular weight of 386.63 g/mol. Its IUPAC name is N,N'-bis[3-(dimethylamino)propyldisulfanyl]oxamide.
| Compound Name | N,N'-bis[3-(dimethylamino)propyldisulfanyl]oxamide |
|---|---|
| PubChem CID | 21150783 |
| Molecular Formula | C12H26N4O2S4 |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N,N'-bis[3-(dimethylamino)propyldisulfanyl]oxamide |
| SMILES | CN(C)CCCSSNC(=O)C(=O)NSSCCCN(C)C |
| InChI | InChI=1S/C12H26N4O2S4/c1-15(2)7-5-9-19-21-13-11(17)12(18)14-22-20-10-6-8-16(3)4/h5-10H2,1-4H3,(H,13,17)(H,14,18) |
| InChIKey | BCXSNULCPMAWQV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|