About S-(dimethylamino) 6-aminohexanethioate
S-(dimethylamino) 6-aminohexanethioate (PubChem CID 54348983) has the molecular formula C8H18N2OS
and a molecular weight of 190.31 g/mol. Its IUPAC name is S-(dimethylamino) 6-aminohexanethioate.
Molecular Properties
| Compound Name | S-(dimethylamino) 6-aminohexanethioate |
| PubChem CID | 54348983 |
| Molecular Formula | C8H18N2OS |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | S-(dimethylamino) 6-aminohexanethioate |
| SMILES | CN(C)SC(=O)CCCCCN |
| InChI | InChI=1S/C8H18N2OS/c1-10(2)12-8(11)6-4-3-5-7-9/h3-7,9H2,1-2H3 |
| InChIKey | YTWJXBXNINEPPF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(dimethylamino) 6-aminohexanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(dimethylamino) 6-aminohexanethioate?
The IUPAC name of S-(dimethylamino) 6-aminohexanethioate (CID 54348983) is S-(dimethylamino) 6-aminohexanethioate.
What is the SMILES notation for S-(dimethylamino) 6-aminohexanethioate?
The canonical SMILES for S-(dimethylamino) 6-aminohexanethioate is CN(C)SC(=O)CCCCCN.
What is the InChIKey of S-(dimethylamino) 6-aminohexanethioate?
The InChIKey is YTWJXBXNINEPPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2OS/c1-10(2)12-8(11)6-4-3-5-7-9/h3-7,9H2,1-2H3.
What are the key properties of S-(dimethylamino) 6-aminohexanethioate?
S-(dimethylamino) 6-aminohexanethioate has a molecular weight of 190.31 g/mol, XLogP of 1.24, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(dimethylamino) 6-aminohexanethioate is sourced from PubChem (CID 54348983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).