C16H34N2OS4 — CID 148563347
3-[3-(3-aminopropylsulfanyl)propylsulfanyl]-N-methyl-N-[3-(3-sulfanylpropylsulfanyl)propyl]propanamide (PubChem CID 148563347) has the molecular formula C16H34N2OS4 and a molecular weight of 398.73 g/mol. Its IUPAC name is 3-[3-(3-aminopropylsulfanyl)propylsulfanyl]-N-methyl-N-[3-(3-sulfanylpropylsulfanyl)propyl]propanamide.
| Compound Name | 3-[3-(3-aminopropylsulfanyl)propylsulfanyl]-N-methyl-N-[3-(3-sulfanylpropylsulfanyl)propyl]propanamide |
|---|---|
| PubChem CID | 148563347 |
| Molecular Formula | C16H34N2OS4 |
| Molecular Weight | 398.73 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-[3-(3-aminopropylsulfanyl)propylsulfanyl]-N-methyl-N-[3-(3-sulfanylpropylsulfanyl)propyl]propanamide |
| SMILES | CN(CCCSCCCS)C(=O)CCSCCCSCCCN |
| InChI | InChI=1S/C16H34N2OS4/c1-18(8-3-11-22-12-4-9-20)16(19)6-15-23-14-5-13-21-10-2-7-17/h20H,2-15,17H2,1H3 |
| InChIKey | MVKUZEMMUXMWOR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.73 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|