methylsulfanylmethyl 3-(dimethylamino)propanoate

C7H15NO2S — CID 129287916

IUPACmethylsulfanylmethyl 3-(dimethylamino)propanoate
SMILESCSCOC(=O)CCN(C)C
InChIInChI=1S/C7H15NO2S/c1-8(2)5-4-7(9)10-6-11-3/h4-6H2,1-3H3
InChIKeyUAPQHPRCBXMTOL-UHFFFAOYSA-N
MW177.27 g/mol
LogP0.80
Rot. Bonds5

About methylsulfanylmethyl 3-(dimethylamino)propanoate

methylsulfanylmethyl 3-(dimethylamino)propanoate (PubChem CID 129287916) has the molecular formula C7H15NO2S and a molecular weight of 177.27 g/mol. Its IUPAC name is methylsulfanylmethyl 3-(dimethylamino)propanoate.

Molecular Properties

Compound Namemethylsulfanylmethyl 3-(dimethylamino)propanoate
PubChem CID129287916
Molecular FormulaC7H15NO2S
Molecular Weight177.27 g/mol
Exact Mass177.08
IUPAC Namemethylsulfanylmethyl 3-(dimethylamino)propanoate
SMILESCSCOC(=O)CCN(C)C
InChIInChI=1S/C7H15NO2S/c1-8(2)5-4-7(9)10-6-11-3/h4-6H2,1-3H3
InChIKeyUAPQHPRCBXMTOL-UHFFFAOYSA-N
XLogP0.80
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.27
LogP ≤ 50.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze methylsulfanylmethyl 3-(dimethylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methylsulfanylmethyl 3-(dimethylamino)propanoate?
The IUPAC name of methylsulfanylmethyl 3-(dimethylamino)propanoate (CID 129287916) is methylsulfanylmethyl 3-(dimethylamino)propanoate.
What is the SMILES notation for methylsulfanylmethyl 3-(dimethylamino)propanoate?
The canonical SMILES for methylsulfanylmethyl 3-(dimethylamino)propanoate is CSCOC(=O)CCN(C)C.
What is the InChIKey of methylsulfanylmethyl 3-(dimethylamino)propanoate?
The InChIKey is UAPQHPRCBXMTOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2S/c1-8(2)5-4-7(9)10-6-11-3/h4-6H2,1-3H3.
What are the key properties of methylsulfanylmethyl 3-(dimethylamino)propanoate?
methylsulfanylmethyl 3-(dimethylamino)propanoate has a molecular weight of 177.27 g/mol, XLogP of 0.80, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanylmethyl 3-(dimethylamino)propanoate is sourced from PubChem (CID 129287916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).