About methylsulfanylmethyl 3-(dimethylamino)propanoate
methylsulfanylmethyl 3-(dimethylamino)propanoate (PubChem CID 129287916) has the molecular formula C7H15NO2S
and a molecular weight of 177.27 g/mol. Its IUPAC name is methylsulfanylmethyl 3-(dimethylamino)propanoate.
Molecular Properties
| Compound Name | methylsulfanylmethyl 3-(dimethylamino)propanoate |
| PubChem CID | 129287916 |
| Molecular Formula | C7H15NO2S |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | methylsulfanylmethyl 3-(dimethylamino)propanoate |
| SMILES | CSCOC(=O)CCN(C)C |
| InChI | InChI=1S/C7H15NO2S/c1-8(2)5-4-7(9)10-6-11-3/h4-6H2,1-3H3 |
| InChIKey | UAPQHPRCBXMTOL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methylsulfanylmethyl 3-(dimethylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfanylmethyl 3-(dimethylamino)propanoate?
The IUPAC name of methylsulfanylmethyl 3-(dimethylamino)propanoate (CID 129287916) is methylsulfanylmethyl 3-(dimethylamino)propanoate.
What is the SMILES notation for methylsulfanylmethyl 3-(dimethylamino)propanoate?
The canonical SMILES for methylsulfanylmethyl 3-(dimethylamino)propanoate is CSCOC(=O)CCN(C)C.
What is the InChIKey of methylsulfanylmethyl 3-(dimethylamino)propanoate?
The InChIKey is UAPQHPRCBXMTOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2S/c1-8(2)5-4-7(9)10-6-11-3/h4-6H2,1-3H3.
What are the key properties of methylsulfanylmethyl 3-(dimethylamino)propanoate?
methylsulfanylmethyl 3-(dimethylamino)propanoate has a molecular weight of 177.27 g/mol, XLogP of 0.80, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanylmethyl 3-(dimethylamino)propanoate is sourced from PubChem (CID 129287916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).