C8H19Cl2N3O2 — CID 87710787
(2R)-2-[3-(dimethylamino)propanoylamino]propanamide;dihydrochloride (PubChem CID 87710787) has the molecular formula C8H19Cl2N3O2 and a molecular weight of 260.16 g/mol. Its IUPAC name is (2R)-2-[3-(dimethylamino)propanoylamino]propanamide;dihydrochloride.
| Compound Name | (2R)-2-[3-(dimethylamino)propanoylamino]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 87710787 |
| Molecular Formula | C8H19Cl2N3O2 |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (2R)-2-[3-(dimethylamino)propanoylamino]propanamide;dihydrochloride |
| SMILES | C[C@@H](NC(=O)CCN(C)C)C(N)=O.Cl.Cl |
| InChI | InChI=1S/C8H17N3O2.2ClH/c1-6(8(9)13)10-7(12)4-5-11(2)3;;/h6H,4-5H2,1-3H3,(H2,9,13)(H,10,12);2*1H/t6-;;/m1../s1 |
| InChIKey | UOYCYQBKDXWNAL-QYCVXMPOSA-N |
| XLogP | -0.23 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |