C23H50N3O3PS — CID 58534077
S-[3-bis[di(propan-2-yl)amino]phosphanyloxypropoxymethyl] 3-(diethylamino)propanethioate (PubChem CID 58534077) has the molecular formula C23H50N3O3PS and a molecular weight of 479.71 g/mol. Its IUPAC name is S-[3-bis[di(propan-2-yl)amino]phosphanyloxypropoxymethyl] 3-(diethylamino)propanethioate.
| Compound Name | S-[3-bis[di(propan-2-yl)amino]phosphanyloxypropoxymethyl] 3-(diethylamino)propanethioate |
|---|---|
| PubChem CID | 58534077 |
| Molecular Formula | C23H50N3O3PS |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.33 |
| IUPAC Name | S-[3-bis[di(propan-2-yl)amino]phosphanyloxypropoxymethyl] 3-(diethylamino)propanethioate |
| SMILES | CCN(CC)CCC(=O)SCOCCCOP(N(C(C)C)C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C23H50N3O3PS/c1-11-24(12-2)15-14-23(27)31-18-28-16-13-17-29-30(25(19(3)4)20(5)6)26(21(7)8)22(9)10/h19-22H,11-18H2,1-10H3 |
| InChIKey | OMCXNPRZKBJSDE-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|