C8H19ClNOP — CID 14867282
N-[chloro(ethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 14867282) has the molecular formula C8H19ClNOP and a molecular weight of 211.67 g/mol. Its IUPAC name is N-[chloro(ethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[chloro(ethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 14867282 |
| Molecular Formula | C8H19ClNOP |
| Molecular Weight | 211.67 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | N-[chloro(ethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | CCOP(Cl)N(C(C)C)C(C)C |
| InChI | InChI=1S/C8H19ClNOP/c1-6-11-12(9)10(7(2)3)8(4)5/h7-8H,6H2,1-5H3 |
| InChIKey | ZTSUQDFQNMCWAM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.67 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|