C9H18ClN2O3P — CID 54084108
(2-chloro-2-cyanoethyl)peroxy-N,N-di(propan-2-yl)phosphonamidous acid (PubChem CID 54084108) has the molecular formula C9H18ClN2O3P and a molecular weight of 268.68 g/mol. Its IUPAC name is (2-chloro-2-cyanoethyl)peroxy-N,N-di(propan-2-yl)phosphonamidous acid.
| Compound Name | (2-chloro-2-cyanoethyl)peroxy-N,N-di(propan-2-yl)phosphonamidous acid |
|---|---|
| PubChem CID | 54084108 |
| Molecular Formula | C9H18ClN2O3P |
| Molecular Weight | 268.68 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (2-chloro-2-cyanoethyl)peroxy-N,N-di(propan-2-yl)phosphonamidous acid |
| SMILES | CC(C)N(C(C)C)P(O)OOCC(Cl)C#N |
| InChI | InChI=1S/C9H18ClN2O3P/c1-7(2)12(8(3)4)16(13)15-14-6-9(10)5-11/h7-9,13H,6H2,1-4H3 |
| InChIKey | MPESKKDRBAIFOV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.68 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|