chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid

C7H17ClNO3P — CID 19786291

IUPACchloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid
SMILESCC(C)N(COOP(O)Cl)C(C)C
InChIInChI=1S/C7H17ClNO3P/c1-6(2)9(7(3)4)5-11-12-13(8)10/h6-7,10H,5H2,1-4H3
InChIKeyNKOBWDNHKFLBTA-UHFFFAOYSA-N
MW229.64 g/mol
LogP2.47
Rot. Bonds6

About chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid

chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid (PubChem CID 19786291) has the molecular formula C7H17ClNO3P and a molecular weight of 229.64 g/mol. Its IUPAC name is chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid.

Molecular Properties

Compound Namechloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid
PubChem CID19786291
Molecular FormulaC7H17ClNO3P
Molecular Weight229.64 g/mol
Exact Mass229.06
IUPAC Namechloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid
SMILESCC(C)N(COOP(O)Cl)C(C)C
InChIInChI=1S/C7H17ClNO3P/c1-6(2)9(7(3)4)5-11-12-13(8)10/h6-7,10H,5H2,1-4H3
InChIKeyNKOBWDNHKFLBTA-UHFFFAOYSA-N
XLogP2.47
TPSA41.93 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.64
LogP ≤ 52.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid?
The IUPAC name of chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid (CID 19786291) is chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid.
What is the SMILES notation for chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid?
The canonical SMILES for chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid is CC(C)N(COOP(O)Cl)C(C)C.
What is the InChIKey of chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid?
The InChIKey is NKOBWDNHKFLBTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17ClNO3P/c1-6(2)9(7(3)4)5-11-12-13(8)10/h6-7,10H,5H2,1-4H3.
What are the key properties of chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid?
chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid has a molecular weight of 229.64 g/mol, XLogP of 2.47, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-[[di(propan-2-yl)amino]methylperoxy]phosphinous acid is sourced from PubChem (CID 19786291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).