C9H23NO — CID 145105271
2-[di(propan-2-yl)amino]ethanol;methane (PubChem CID 145105271) has the molecular formula C9H23NO and a molecular weight of 161.29 g/mol. Its IUPAC name is 2-[di(propan-2-yl)amino]ethanol;methane.
| Compound Name | 2-[di(propan-2-yl)amino]ethanol;methane |
|---|---|
| PubChem CID | 145105271 |
| Molecular Formula | C9H23NO |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.18 |
| IUPAC Name | 2-[di(propan-2-yl)amino]ethanol;methane |
| SMILES | C.CC(C)N(CCO)C(C)C |
| InChI | InChI=1S/C8H19NO.CH4/c1-7(2)9(5-6-10)8(3)4;/h7-8,10H,5-6H2,1-4H3;1H4 |
| InChIKey | MNMQAHCWLDTKGU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |