C21H44N2O3 — CID 138617266
2-[di(propan-2-yl)amino]ethanol;2-[(2-hydroxycyclohexyl)-methylamino]cyclohexan-1-ol (PubChem CID 138617266) has the molecular formula C21H44N2O3 and a molecular weight of 372.59 g/mol. Its IUPAC name is 2-[di(propan-2-yl)amino]ethanol;2-[(2-hydroxycyclohexyl)-methylamino]cyclohexan-1-ol.
| Compound Name | 2-[di(propan-2-yl)amino]ethanol;2-[(2-hydroxycyclohexyl)-methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 138617266 |
| Molecular Formula | C21H44N2O3 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.34 |
| IUPAC Name | 2-[di(propan-2-yl)amino]ethanol;2-[(2-hydroxycyclohexyl)-methylamino]cyclohexan-1-ol |
| SMILES | CC(C)N(CCO)C(C)C.CN(C1CCCCC1O)C1CCCCC1O |
| InChI | InChI=1S/C13H25NO2.C8H19NO/c1-14(10-6-2-4-8-12(10)15)11-7-3-5-9-13(11)16;1-7(2)9(5-6-10)8(3)4/h10-13,15-16H,2-9H2,1H3;7-8,10H,5-6H2,1-4H3 |
| InChIKey | JXLALLHCZSDYDG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |