About [butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite
[butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite (PubChem CID 88635380) has the molecular formula C7H17ClNO3P
and a molecular weight of 229.64 g/mol. Its IUPAC name is [butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite.
Molecular Properties
| Compound Name | [butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite |
| PubChem CID | 88635380 |
| Molecular Formula | C7H17ClNO3P |
| Molecular Weight | 229.64 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | [butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite |
| SMILES | CCC(C)N(OP(O)OCl)C(C)C |
| InChI | InChI=1S/C7H17ClNO3P/c1-5-7(4)9(6(2)3)12-13(10)11-8/h6-7,10H,5H2,1-4H3 |
| InChIKey | GQOXDBCTEQMJGQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.64 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite?
The IUPAC name of [butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite (CID 88635380) is [butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite.
What is the SMILES notation for [butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite?
The canonical SMILES for [butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite is CCC(C)N(OP(O)OCl)C(C)C.
What is the InChIKey of [butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite?
The InChIKey is GQOXDBCTEQMJGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17ClNO3P/c1-5-7(4)9(6(2)3)12-13(10)11-8/h6-7,10H,5H2,1-4H3.
What are the key properties of [butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite?
[butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite has a molecular weight of 229.64 g/mol, XLogP of 2.82, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [butan-2-yl(propan-2-yl)amino] chloro hydrogen phosphite is sourced from PubChem (CID 88635380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).