C4H11Cl4NSi2 — CID 159107180
N,N-bis(dichlorosilyl)butan-2-amine (PubChem CID 159107180) has the molecular formula C4H11Cl4NSi2 and a molecular weight of 271.12 g/mol. Its IUPAC name is N,N-bis(dichlorosilyl)butan-2-amine.
| Compound Name | N,N-bis(dichlorosilyl)butan-2-amine |
|---|---|
| PubChem CID | 159107180 |
| Molecular Formula | C4H11Cl4NSi2 |
| Molecular Weight | 271.12 g/mol |
| Exact Mass | 268.92 |
| IUPAC Name | N,N-bis(dichlorosilyl)butan-2-amine |
| SMILES | CCC(C)N([SiH](Cl)Cl)[SiH](Cl)Cl |
| InChI | InChI=1S/C4H11Cl4NSi2/c1-3-4(2)9(10(5)6)11(7)8/h4,10-11H,3H2,1-2H3 |
| InChIKey | KEANFKQCUIIPDY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.12 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|