C12H28N2 — CID 58105681
N-methyl-N,N',N'-tri(propan-2-yl)ethane-1,2-diamine (PubChem CID 58105681) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is N-methyl-N,N',N'-tri(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N-methyl-N,N',N'-tri(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 58105681 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | N-methyl-N,N',N'-tri(propan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)N(C)CCN(C(C)C)C(C)C |
| InChI | InChI=1S/C12H28N2/c1-10(2)13(7)8-9-14(11(3)4)12(5)6/h10-12H,8-9H2,1-7H3 |
| InChIKey | PXOMRDISLMOZRP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |